Greek and Hebrew interlinear

Numbers 23 Hebrew–English interlinear

Leer en español

Read this chapter in WLC Read this chapter in Brenton

Notes on this text (1)

Tap a word for its dictionary entry.

1

  1. vai.Yo.merH559HC/Vqw3msand he said
  2. bil.'AmH1109HNpBalaam
  3. 'el-H413HRto
  4. ba.LakH1111HNpBalak
  5. be.neh-H1129HVqv2msbuild
  6. liHR/Sp1csfor <the> me
  7. va.ZehH2088HR/Pdxmsin this [place]
  8. shiv.'AhH7651HAcmsaseven
  9. miz.be.ChotH4196HNcmpaaltars
  10. ve.ha.KhenH3559HC/Vhv2msand prepare
  11. liHR/Sp1csfor <the> me
  12. ba.ZehH2088HR/Pdxmsin this [place]
  13. shiv.'AhH7651HAcmsaseven
  14. fa.RimH6499HNcmpayoung bulls
  15. ve.shiv.'AhH7651HC/Acmsaand seven
  16. 'ei.LimH352HNcmparams

2

  1. vai.Ya.'asH6213HC/Vqw3msand he did
  2. ba.LakH1111HNpBalak
  3. ka.'a.SherH834HR/Trjust as
  4. di.BerH1696HVpp3mshe had spoken
  5. bil.'AmH1109HNpBalaam
  6. vai.Ya.'alH5927HC/Vhw3msand he offered up
  7. ba.LakH1111HNpBalak
  8. u.vil.'AmH1109HC/Npand Balaam
  9. parH6499HNcmsaa young bull
  10. va.'A.yilH352HC/Ncmsaand a ram
  11. ba.miz.Be.achH4196HRd/Ncmsaon the altar

3

  1. vai.Yo.merH559HC/Vqw3msand he said
  2. bil.'AmH1109HNpBalaam
  3. le.va.LakH1111HR/Npto Balak
  4. hit.ya.TzevH3320HVtv2mstake your stand
  5. 'al-H5921HRwith
  6. 'o.la.te.KhaH5930HNcfsc/Sp2msburnt offering your
  7. ve.'e.le.KhahH3212HC/Vqh1csso let me go
  8. 'u.LaiH194HDperhaps
  9. yi.ka.RehH7136HVNi3mshe will meet
  10. Yah.wehH3068HNpYahweh
  11. lik.ra.TiH7125HR/Vqc/Sp1csto meet me
  12. u.de.VarH1697HC/Ncmscand [the] word of
  13. mah-H4100HTiwhatever
  14. yar.'E.niH7200HVhi3ms/Sp1cshe will show me
  15. ve.hi.Gad.tiH5046HC/Vhq1csand I will tell
  16. LakhHR/Sp2fsto <the> you
  17. vai.Ye.lekhH3212HC/Vqw3msand he went
  18. She.fiH8205HNcmsaa bare height

4

  1. vai.yi.KarH7136HC/VNw3msand he met
  2. 'E.lo.HimH430HNcmpaGod
  3. 'el-H413HR<to>
  4. bil.'AmH1109HNpBalaam
  5. vai.Yo.merH559HC/Vqw3msand he said
  6. 'e.LavH413HR/Sp3msto him
  7. 'et-H853HTo<obj.>
  8. shiv.'AtH7651HAcmsc[the] seven
  9. ha.miz.be.ChotH4196HTd/Ncmpathe altars
  10. 'a.Rakh.tiH6186HVqp1csI have arranged
  11. va.'A.'alH5927HC/Vhw1csand I have offered up
  12. parH6499HNcmsaa young bull
  13. va.'A.yilH352HC/Ncmsaand a ram
  14. ba.miz.Be.achH4196HRd/Ncmsaon the altar

5

  1. vai.Ya.semH7760HC/Vqw3msand he put
  2. Yah.wehH3068HNpYahweh
  3. da.VarH1697HNcmsaa word
  4. be.FiH6310HR/Ncmscin [the] mouth of
  5. vil.'AmH1109HNpBalaam
  6. vai.Yo.merH559HC/Vqw3msand he said
  7. shuvH7725HVqv2msreturn
  8. 'el-H413HRto
  9. ba.LakH1111HNpBalak
  10. ve.KhohH3541HC/Dand thus
  11. te.da.BerH1696HVpi2msyou will speak

6

  1. vai.Ya.shovH7725HC/Vqw3msand he returned
  2. 'e.LavH413HR/Sp3msto him
  3. ve.hi.NehH2009HC/Tmand there!
  4. ni.TzavH5324HVNrmsa[he was] standing
  5. 'al-H5921HRwith
  6. o.la.ToH5930HNcfsc/Sp3msburnt offering his
  7. hu'H1931HPp3mshe
  8. ve.kholH3605HC/Ncmscand all
  9. sa.ReiH8269HNcmpc[the] leaders of
  10. mo.'AvH4124HNpMoab

7

  1. vai.yi.Sa'H5375HC/Vqw3msand he lifted up
  2. me.sha.LoH4912HNcmsc/Sp3msoracle his
  3. vai.yo.MarH559HC/Vqw3msand he said
  4. min-H4480HRfrom
  5. 'A.romH758HNpAram
  6. yan.Che.niH5148HVhi3ms/Sp1cshe led me
  7. va.LakH1111HNpBalak
  8. Me.lekh-H4428HNcmsc[the] king of
  9. mo.'AvH4124HNpMoab
  10. me.ha.rei-H2042HR/Ncmpcfrom [the] mountains of
  11. Ke.demH6924HNcmsa[the] east
  12. le.KhahH3212HVqv2ms/Shcome !
  13. 'a.rah-H779HVqv2ms/Shcurse !
  14. liHR/Sp1csfor <the> me
  15. ya.'a.KoH3290HNpJacob
  16. u.le.KhahH3212HC/Vqv2ms/Shand come !
  17. zo.'a.MahH2194HVqv2ms/Shdenounce !
  18. Yis.ra.'ElH3478HNpIsrael

8

  1. mahH4100HTiwhat?
  2. 'e.KoH5344HVqi1cswill I curse
  3. lo'H3808HTn[one whom] not
  4. ka.BohH6895HVqp3ms/Sp3mshe has cursed him
  5. 'ElH410HNcmsaGod
  6. u.MahH4100HC/Tiand what?
  7. 'ez.'OmH2194HVqi1cswill I denounce
  8. lo'H3808HTn[one whom] not
  9. za.'AmH2194HVqp3mshe has denounced
  10. Yah.wehH3068HNpYahweh

9

  1. ki-H3588HCfor
  2. me.RoshH7218HR/Ncmscfrom [the] top of
  3. tzu.RimH6697HNcmpa[the] rocks
  4. 'er.'E.nuH7200HVqi1cs/Sp3msI see him
  5. u.mi.ge.va.'otH1389HC/R/Ncfpaand from [the] hills
  6. 'a.shu.Re.nuH7789HVqi1cs/Sp3msI observe him
  7. hen-H2005HTjthere!
  8. 'amH5971HNcmsaa people
  9. le.va.DadH910HR/Ncmsa[which] <to> alone
  10. yish.KonH7931HVqi3msit dwells
  11. u.va.go.YimH1471HC/Rd/Ncmpaand among the nations
  12. lo'H3808HTnnot
  13. yit.cha.ShavH2803HVti3msit reckons itself

10

  1. miH4310HTiwho?
  2. ma.NahH4487HVqp3mshas he counted
  3. 'a.FarH6083HNcmsc[the] dust of
  4. ya.'a.KoH3290HNpJacob
  5. u.mis.ParH4557HC/Ncmsaand a number
  6. 'et-H853HTo<obj.>
  7. Roa'H7255HNcmsc[the] fourth part of
  8. Yis.ra.'ElH3478HNpIsrael
  9. ta.MotH4191HVqj3fslet it die
  10. naf.ShiH5315HNcbsc/Sp1csself my
  11. MotH4194HNcmsc[the] death of
  12. ye.sha.RimH3477HAampaupright [people]
  13. u.te.HiH1961HC/Vqj3fsand let it be
  14. 'a.cha.ri.TiH319HNcfsc/Sp1csend my
  15. ka.Mo.huH3644HR/Sp3mslike his

11

  1. vai.Yo.merH559HC/Vqw3msand he said
  2. ba.LakH1111HNpBalak
  3. 'el-H413HRto
  4. bil.'AmH1109HNpBalaam
  5. mehH4100HTiwhat?
  6. 'a.Si.taH6213HVqp2mshave you done
  7. LiHR/Sp1csto <the> me
  8. la.KoH6895HR/Vqcto curse
  9. 'o.ye.VaiH341HVqrmpc/Sp1csenemies my
  10. le.kach.Ti.khaH3947HVqp1cs/Sp2msI took you
  11. ve.hi.NehH2009HC/Tmand here!
  12. be.Rakh.taH1288HVpp2msyou have blessed
  13. va.RekhH1288HVpaactually <bless>

12

  1. vai.Ya.'anH6030HC/Vqw3msand he answered
  2. vai.yo.MarH559HC/Vqw3msand he said
  3. ha.Lo'H3808HTi/Tn¿ not
  4. 'etH853HTo<obj.>
  5. 'a.SherH834HTr[that] which
  6. ya.SimH7760HVqi3mshe will put
  7. Yah.wehH3068HNpYahweh
  8. be.FiH6310HR/Ncmsc/Sp1csin mouth my
  9. 'o.ToH853HTo/Sp3ms<obj.> it
  10. 'esh.MorH8104HVqi1cswill I take care
  11. le.da.BerH1696HR/Vpcto speak

13

  1. vai.Yo.merH559HC/Vqw3msand he said
  2. 'e.LavH413HR/Sp3msto him
  3. ba.LakH1111HNpBalak
  4. H3212HVqv2msgo
  5. na'H3212HTjplease
  6. 'i.TiH854HR/Sp1cswith me
  7. 'el-H413HRto
  8. ma.KomH4725HNcmsaa place
  9. 'a.CherH312HAamsaanother
  10. 'a.SherH834HTrwhere
  11. tir.'E.nuH7200HVqi2ms/Sp3msyou will see it
  12. mi.ShamH8033HR/Dfrom there
  13. 'E.fesH657HNcmsaonly
  14. ka.Tze.huH7097HNcbsc/Sp3msoutskirt[s] its
  15. tir.'EhH7200HVqi2msyou will see
  16. ve.khu.LoH3605HC/Ncmsc/Sp3msand all of it
  17. lo'H3808HTnnot
  18. tir.'EhH7200HVqi2msyou will see
  19. ve.ka.ve.nov-H6895HC/Vqv2ms/Sp3msand curse it
  20. liHR/Sp1csfor <the> me
  21. mi.ShamH8033HR/Dfrom there

14

  1. vai.yi.ka.Che.huH3947HC/Vqw3ms/Sp3msand he took him
  2. se.DehH7704HNcmsc[the] field of
  3. tzo.FimH6839HVqrmpaZophim
  4. 'el-H413HRto
  5. roshH7218HNcmsc[the] top of
  6. ha.pis.GahH6449HTd/Np<the> Pisgah
  7. vai.Yi.venH1129HC/Vqw3msand he built
  8. shiv.'AhH7651HAcmsaseven
  9. miz.be.ChotH4196HNcmpaaltars
  10. vai.Ya.'alH5927HC/Vhw3msand he offered up
  11. parH6499HNcmsaa young bull
  12. va.'A.yilH352HC/Ncmsaand a ram
  13. ba.miz.Be.achH4196HRd/Ncmsaon the altar

15

  1. vai.Yo.merH559HC/Vqw3msand he said
  2. 'el-H413HRto
  3. ba.LakH1111HNpBalak
  4. hit.ya.TzevH3320HVtv2mstake your stand
  5. kohH3541HDthus
  6. 'al-H5921HRwith
  7. 'o.la.Te.khaH5930HNcfsc/Sp2msburnt offering your
  8. ve.'a.no.KhiH595HC/Pp1csand I
  9. 'i.Ka.rehH7136HVNi1csI will meet
  10. KohH3541HDthus

16

  1. vai.yi.KarH7136HC/VNw3msand he met
  2. Yah.wehH3068HNpYahweh
  3. 'el-H413HR<to>
  4. bil.'AmH1109HNpBalaam
  5. vai.Ya.semH7760HC/Vqw3msand he put
  6. da.VarH1697HNcmsaa word
  7. be.FivH6310HR/Ncmsc/Sp3msin mouth his
  8. vai.Yo.merH559HC/Vqw3msand he said
  9. shuvH7725HVqv2msreturn
  10. 'el-H413HRto
  11. ba.LakH1111HNpBalak
  12. ve.KhohH3541HC/Dand thus
  13. te.da.BerH1696HVpi2msyou will speak

17

  1. vai.ya.Vo'H935HC/Vqw3msand he went
  2. 'e.LavH413HR/Sp3msto him
  3. ve.hi.NoH2009HC/Tm/Sp3msand there he
  4. ni.TzavH5324HVNrmsa[was] standing
  5. 'al-H5921HRwith
  6. o.la.ToH5930HNcfsc/Sp3msburnt offering his
  7. ve.sa.ReiH8269HC/Ncmpcand [the] leaders of
  8. mo.'AvH4124HNpMoab
  9. 'i.ToH854HR/Sp3ms[were] with him
  10. vai.Yo.merH559HC/Vqw3msand he said
  11. loHR/Sp3msto <the> him
  12. ba.LakH1111HNpBalak
  13. mah-H4100HTiwhat?
  14. di.BerH1696HVpp3mshas he spoken
  15. Yah.wehH3068HNpYahweh

18

  1. vai.yi.Sa'H5375HC/Vqw3msand he lifted up
  2. me.sha.LoH4912HNcmsc/Sp3msoracle his
  3. vai.yo.MarH559HC/Vqw3msand he said
  4. kumH6965HVqv2msarise
  5. ba.LakH1111HNpO Balak
  6. u.sha.Ma'H8085HC/Vqv2msand hear
  7. ha.'a.Zi.nahH238HVhv2ms/Shgive ear !
  8. 'a.DaiH5704HR/Sp1csto me
  9. be.NoH1121HNcmsc/Sp3ms[O] son his
  10. tzi.PorH6834HNpZippor

19

  1. lo'H3808HTnnot
  2. 'ishH376HNcmsa[is] a human
  3. 'elH410HNcmsaGod
  4. vi.kha.ZevH3576HC/Vpi3msso he may lie
  5. u.ven-H1121HC/Ncmscand a son of
  6. 'a.DamH120HNcmsahumankind
  7. ve.yit.ne.ChamH5162HC/Vti3msso he may change his mind
  8. ha.Hu'H1931HTd/Pp3ms¿ he
  9. 'a.MarH559HVqp3mshas he said
  10. ve.Lo'H3808HC/Tnand not
  11. ya.'a.SehH6213HVqi3mswill he act?
  12. ve.di.BerH1696HC/Vpp3msand has he spoken?
  13. ve.Lo'H3808HC/Tnand not
  14. ye.ki.Me.nahH6965HVhi3ms/Sp3fswill he fulfill? it

20

  1. hi.NehH2009HTmhere!
  2. va.RekhH1288HVpa[surely] blessing
  3. la.Ka.che.tiH3947HVqp1csI have received
  4. u.ve.RekhH1288HC/Vpp3msand he has blessed
  5. ve.Lo'H3808HC/Tnand not
  6. 'a.shi.Ve.nahH7725HVhi1cs/Sp3fsI will turn back it

21

  1. lo'-H3808HTnnot
  2. hi.BitH5027HVhp3mshe has looked at
  3. 'a.venH205HNcmsadisaster
  4. be.ya.'a.KoH3290HR/Npin Jacob
  5. ve.lo'-H3808HC/Tnand not
  6. ra.'AhH7200HVqp3mshe has seen
  7. 'a.MalH5999HNcbsatrouble
  8. be.Yis.ra.'ElH3478HR/Npin Israel
  9. Yah.wehH3068HNpYahweh
  10. 'e.lo.HavH430HNcmpc/Sp3msGod his
  11. i.MoH5973HR/Sp3ms[is] with him
  12. u.te.ru.'AtH8643HC/Ncfscand a shout of
  13. Me.lekhH4428HNcmsaa king
  14. boHR/Sp3ms[is] among <the> him

22

  1. 'elH410HNcmsaGod
  2. mo.tzi.'AmH3318HVhrmsc/Sp3mp[is] bringing out them
  3. mi.mitz.Ra.yimH4714HR/Npfrom Egypt
  4. ke.to.'a.FotH8443HR/Ncfpclike [the] horns of
  5. re.'EmH7214HNcmsaa wild ox
  6. loHR/Sp3ms[belong] to <the> him

23

  1. kiH3588HCfor
  2. lo'-H3808HTnnot
  3. na.chashH5173HNcmsaenchantment
  4. be.ya.'a.KoH3290HR/Np[is] in Jacob
  5. ve.lo'-H3808HC/Tnand not
  6. Ke.semH7081HNcmsadivination
  7. be.Yis.ra.'ElH3478HR/Np[is] in Israel
  8. ka.'EtH6256HRd/Ncbsaabout <the> this time
  9. ye.'a.MerH559HVNi3msit will be said
  10. le.ya.'a.KoH3290HR/Npof Jacob
  11. u.le.Yis.ra.'ElH3478HC/R/Npand of Israel
  12. mah-H4100HTiwhat!
  13. Pa.'alH6466HVqp3mshas he done
  14. 'ElH410HNcmsaGod

24

  1. hen-H2005HTjthere!
  2. 'amH5971HNcmsaa people
  3. ke.la.Vi'H3833HR/Ncbsalike a lion
  4. ya.KumH6965HVqi3msit rises
  5. ve.kha.'a.RiH738HC/R/Ncmsaand like a lion
  6. yit.na.Sa'H5375HVti3msit lifts itself up
  7. lo'H3808HTnnot
  8. yish.KavH7901HVqi3msit will lie down
  9. 'ad-H5704HRuntil
  10. Yo.khalH398HVqi3msit will devour
  11. Te.refH2964HNcmsaprey
  12. ve.dam-H1818HC/Ncmscand [the] blood of
  13. cha.la.LimH2491HAampa[those] slain
  14. yish.TehH8354HVqi3msit will drink

25

  1. vai.Yo.merH559HC/Vqw3msand he said
  2. ba.LakH1111HNpBalak
  3. 'el-H413HRto
  4. bil.'AmH1109HNpBalaam
  5. gam-H1571HTaneither
  6. koH6895HVqaat all <curse>
  7. lo'H3808HTnnot
  8. ti.ko.Ve.nuH5344HVqi2ms/Sp3msyou will curse it
  9. gam-H1571HTanor
  10. ba.RekhH1288HVpaat all <bless>
  11. lo'H3808HTnnot
  12. te.va.ra.Khe.nuH1288HVpi2ms/Sp3msyou will bless it

26

  1. vai.Ya.'anH6030HC/Vqw3msand he answered
  2. bil.'AmH1109HNpBalaam
  3. vai.Yo.merH559HC/Vqw3msand he said
  4. 'el-H413HRto
  5. ba.LakH1111HNpBalak
  6. ha.Lo'H3808HTi/Tn¿ not
  7. di.Bar.tiH1696HVpp1csdid I speak
  8. 'e.Lei.khaH413HR/Sp2msto you
  9. le.MorH559HR/Vqc<to> saying
  10. kolH3605HNcmsaall
  11. 'a.Sher-H834HTrthat
  12. ye.da.BerH1696HVpi3mshe will speak
  13. Yah.wehH3068HNpYahweh
  14. 'o.ToH853HTo/Sp3ms<obj.> it
  15. 'E.'e.SehH6213HVqi1csI will do

27

  1. vai.Yo.merH559HC/Vqw3msand he said
  2. ba.LakH1111HNpBalak
  3. 'el-H413HRto
  4. bil.'AmH1109HNpBalaam
  5. le.khah-H3212HVqv2ms/Shcome !
  6. na'H4994HTjplease
  7. 'e.Ka.cha.khaH3947HVqh1cs/Sp2mslet me take you
  8. 'el-H413HRto
  9. ma.KomH4725HNcmsaa place
  10. 'a.CherH312HAamsaanother
  11. 'u.LaiH194HDperhaps
  12. yi.SharH3474HVqi3msit will be pleasing
  13. be.'ei.NeiH5869HR/Ncbdcin [the] eyes of
  14. ha.'E.lo.HimH430HTd/Ncmpa<the> God
  15. ve.ka.Bo.tovH6895HC/Vqq2ms/Sp3msand you will curse it
  16. liHR/Sp1csfor <the> me
  17. mi.ShamH8033HR/Dfrom there

28

  1. vai.yi.KachH3947HC/Vqw3msand he took
  2. ba.LakH1111HNpBalak
  3. 'et-H853HTo<obj.>
  4. bil.'AmH1109HNpBalaam
  5. roshH7218HNcmsc[the] top of
  6. ha.pe.'orH6465HTd/Np<the> Peor
  7. ha.nish.KafH8259HTd/VNrmsawhich looks down
  8. 'al-H5921HRover
  9. pe.NeiH6440HNcbpc[the] face of
  10. hay.shi.MonH3452HTd/Ncmsathe desolate place

29

  1. vai.Yo.merH559HC/Vqw3msand he said
  2. bil.'AmH1109HNpBalaam
  3. 'el-H413HRto
  4. ba.LakH1111HNpBalak
  5. be.neh-H1129HVqv2msbuild
  6. liHR/Sp1csfor <the> me
  7. va.ZehH2088HR/Pdxmsin this [place]
  8. shiv.'AhH7651HAcmsaseven
  9. miz.be.ChotH4196HNcmpaaltars
  10. ve.ha.KhenH3559HC/Vhv2msand prepare
  11. liHR/Sp1csfor <the> me
  12. ba.ZehH2088HR/Pdxmsin this [place]
  13. shiv.'AhH7651HAcmsaseven
  14. fa.RimH6499HNcmpayoung bulls
  15. ve.shiv.'AhH7651HC/Acmsaand seven
  16. 'ei.LimH352HNcmparams

30

  1. vai.Ya.'asH6213HC/Vqw3msand he did
  2. ba.LakH1111HNpBalak
  3. ka.'a.SherH834HR/Trjust as
  4. 'a.MarH559HVqp3mshe had said
  5. bil.'AmH1109HNpBalaam
  6. vai.Ya.'alH5927HC/Vhw3msand he offered up
  7. parH6499HNcmsaa young bull
  8. va.'A.yilH352HC/Ncmsaand a ram
  9. ba.miz.Be.achH4196HRd/Ncmsaon the altar